C33H36FN3O4 — CID 11330396
methyl (3E)-3-[(3-fluorophenyl)methoxyimino]-2-[[4-[[1-[4-(2-methylpropyl)phenyl]pyrazol-4-yl]methoxy]phenyl]methyl]butanoate (PubChem CID 11330396) has the molecular formula C33H36FN3O4 and a molecular weight of 557.67 g/mol. Its IUPAC name is methyl (3E)-3-[(3-fluorophenyl)methoxyimino]-2-[[4-[[1-[4-(2-methylpropyl)phenyl]pyrazol-4-yl]methoxy]phenyl]methyl]butanoate.
| Compound Name | methyl (3E)-3-[(3-fluorophenyl)methoxyimino]-2-[[4-[[1-[4-(2-methylpropyl)phenyl]pyrazol-4-yl]methoxy]phenyl]methyl]butanoate |
|---|---|
| PubChem CID | 11330396 |
| Molecular Formula | C33H36FN3O4 |
| Molecular Weight | 557.67 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | methyl (3E)-3-[(3-fluorophenyl)methoxyimino]-2-[[4-[[1-[4-(2-methylpropyl)phenyl]pyrazol-4-yl]methoxy]phenyl]methyl]butanoate |
| SMILES | COC(=O)C(Cc1ccc(OCc2cnn(-c3ccc(CC(C)C)cc3)c2)cc1)/C(C)=N/OCc1cccc(F)c1 |
| InChI | InChI=1S/C33H36FN3O4/c1-23(2)16-25-8-12-30(13-9-25)37-20-28(19-35-37)21-40-31-14-10-26(11-15-31)18-32(33(38)39-4)24(3)36-41-22-27-6-5-7-29(34)17-27/h5-15,17,19-20,23,32H,16,18,21-22H2,1-4H3/b36-24+ |
| InChIKey | GOKKOCOQBDCMPD-XBQJKBNESA-N |
| XLogP | 6.71 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.67 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|