C29H28ClN3O4 — CID 11489232
methyl (3E)-2-[[4-[[1-(4-chlorophenyl)pyrazol-4-yl]methoxy]phenyl]methyl]-3-phenylmethoxyiminobutanoate (PubChem CID 11489232) has the molecular formula C29H28ClN3O4 and a molecular weight of 518.01 g/mol. Its IUPAC name is methyl (3E)-2-[[4-[[1-(4-chlorophenyl)pyrazol-4-yl]methoxy]phenyl]methyl]-3-phenylmethoxyiminobutanoate.
| Compound Name | methyl (3E)-2-[[4-[[1-(4-chlorophenyl)pyrazol-4-yl]methoxy]phenyl]methyl]-3-phenylmethoxyiminobutanoate |
|---|---|
| PubChem CID | 11489232 |
| Molecular Formula | C29H28ClN3O4 |
| Molecular Weight | 518.01 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | methyl (3E)-2-[[4-[[1-(4-chlorophenyl)pyrazol-4-yl]methoxy]phenyl]methyl]-3-phenylmethoxyiminobutanoate |
| SMILES | COC(=O)C(Cc1ccc(OCc2cnn(-c3ccc(Cl)cc3)c2)cc1)/C(C)=N/OCc1ccccc1 |
| InChI | InChI=1S/C29H28ClN3O4/c1-21(32-37-20-23-6-4-3-5-7-23)28(29(34)35-2)16-22-8-14-27(15-9-22)36-19-24-17-31-33(18-24)26-12-10-25(30)11-13-26/h3-15,17-18,28H,16,19-20H2,1-2H3/b32-21+ |
| InChIKey | WHBNNSUOXSRVJO-RUMWWMSVSA-N |
| XLogP | 6.03 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.01 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|