C34H39N3O4 — CID 72773895
methyl 2-methyl-2-[[4-[[1-[4-(2-methylpropyl)phenyl]pyrazol-4-yl]methoxy]phenyl]methyl]-3-phenylmethoxyiminobutanoate (PubChem CID 72773895) has the molecular formula C34H39N3O4 and a molecular weight of 553.70 g/mol. Its IUPAC name is methyl 2-methyl-2-[[4-[[1-[4-(2-methylpropyl)phenyl]pyrazol-4-yl]methoxy]phenyl]methyl]-3-phenylmethoxyiminobutanoate.
| Compound Name | methyl 2-methyl-2-[[4-[[1-[4-(2-methylpropyl)phenyl]pyrazol-4-yl]methoxy]phenyl]methyl]-3-phenylmethoxyiminobutanoate |
|---|---|
| PubChem CID | 72773895 |
| Molecular Formula | C34H39N3O4 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | methyl 2-methyl-2-[[4-[[1-[4-(2-methylpropyl)phenyl]pyrazol-4-yl]methoxy]phenyl]methyl]-3-phenylmethoxyiminobutanoate |
| SMILES | COC(=O)C(C)(Cc1ccc(OCc2cnn(-c3ccc(CC(C)C)cc3)c2)cc1)C(C)=NOCc1ccccc1 |
| InChI | InChI=1S/C34H39N3O4/c1-25(2)19-27-11-15-31(16-12-27)37-22-30(21-35-37)23-40-32-17-13-28(14-18-32)20-34(4,33(38)39-5)26(3)36-41-24-29-9-7-6-8-10-29/h6-18,21-22,25H,19-20,23-24H2,1-5H3 |
| InChIKey | KKUQPIHLWZZYOJ-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|