C12H21FN6 — CID 113305589
[2-[(1,4-dimethylpiperazin-2-yl)methyl]-5-fluoro-6-methylpyrimidin-4-yl]hydrazine (PubChem CID 113305589) has the molecular formula C12H21FN6 and a molecular weight of 268.34 g/mol. Its IUPAC name is [2-[(1,4-dimethylpiperazin-2-yl)methyl]-5-fluoro-6-methylpyrimidin-4-yl]hydrazine.
| Compound Name | [2-[(1,4-dimethylpiperazin-2-yl)methyl]-5-fluoro-6-methylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 113305589 |
| Molecular Formula | C12H21FN6 |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | [2-[(1,4-dimethylpiperazin-2-yl)methyl]-5-fluoro-6-methylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(CC2CN(C)CCN2C)nc(NN)c1F |
| InChI | InChI=1S/C12H21FN6/c1-8-11(13)12(17-14)16-10(15-8)6-9-7-18(2)4-5-19(9)3/h9H,4-7,14H2,1-3H3,(H,15,16,17) |
| InChIKey | WZAZNLPIUSAKSC-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|