About [2-[(1,4-dimethylpiperazin-2-yl)methyl]-5-fluoro-6-methylpyrimidin-4-yl]hydrazine
[2-[(1,4-dimethylpiperazin-2-yl)methyl]-5-fluoro-6-methylpyrimidin-4-yl]hydrazine (PubChem CID 113305589) has the molecular formula C12H21FN6
and a molecular weight of 268.34 g/mol. Its IUPAC name is [2-[(1,4-dimethylpiperazin-2-yl)methyl]-5-fluoro-6-methylpyrimidin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [2-[(1,4-dimethylpiperazin-2-yl)methyl]-5-fluoro-6-methylpyrimidin-4-yl]hydrazine |
| PubChem CID | 113305589 |
| Molecular Formula | C12H21FN6 |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | [2-[(1,4-dimethylpiperazin-2-yl)methyl]-5-fluoro-6-methylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(CC2CN(C)CCN2C)nc(NN)c1F |
| InChI | InChI=1S/C12H21FN6/c1-8-11(13)12(17-14)16-10(15-8)6-9-7-18(2)4-5-19(9)3/h9H,4-7,14H2,1-3H3,(H,15,16,17) |
| InChIKey | WZAZNLPIUSAKSC-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-[(1,4-dimethylpiperazin-2-yl)methyl]-5-fluoro-6-methylpyrimidin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1,4-dimethylpiperazin-2-yl)methyl]-5-fluoro-6-methylpyrimidin-4-yl]hydrazine?
The IUPAC name of [2-[(1,4-dimethylpiperazin-2-yl)methyl]-5-fluoro-6-methylpyrimidin-4-yl]hydrazine (CID 113305589) is [2-[(1,4-dimethylpiperazin-2-yl)methyl]-5-fluoro-6-methylpyrimidin-4-yl]hydrazine.
What is the SMILES notation for [2-[(1,4-dimethylpiperazin-2-yl)methyl]-5-fluoro-6-methylpyrimidin-4-yl]hydrazine?
The canonical SMILES for [2-[(1,4-dimethylpiperazin-2-yl)methyl]-5-fluoro-6-methylpyrimidin-4-yl]hydrazine is Cc1nc(CC2CN(C)CCN2C)nc(NN)c1F.
What is the InChIKey of [2-[(1,4-dimethylpiperazin-2-yl)methyl]-5-fluoro-6-methylpyrimidin-4-yl]hydrazine?
The InChIKey is WZAZNLPIUSAKSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21FN6/c1-8-11(13)12(17-14)16-10(15-8)6-9-7-18(2)4-5-19(9)3/h9H,4-7,14H2,1-3H3,(H,15,16,17).
What are the key properties of [2-[(1,4-dimethylpiperazin-2-yl)methyl]-5-fluoro-6-methylpyrimidin-4-yl]hydrazine?
[2-[(1,4-dimethylpiperazin-2-yl)methyl]-5-fluoro-6-methylpyrimidin-4-yl]hydrazine has a molecular weight of 268.34 g/mol, XLogP of -0.00, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1,4-dimethylpiperazin-2-yl)methyl]-5-fluoro-6-methylpyrimidin-4-yl]hydrazine is sourced from PubChem (CID 113305589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).