C14H24IN5 — CID 115415776
2-[(1,4-dimethylpiperazin-2-yl)methyl]-5-iodo-6-propan-2-ylpyrimidin-4-amine (PubChem CID 115415776) has the molecular formula C14H24IN5 and a molecular weight of 389.29 g/mol. Its IUPAC name is 2-[(1,4-dimethylpiperazin-2-yl)methyl]-5-iodo-6-propan-2-ylpyrimidin-4-amine.
| Compound Name | 2-[(1,4-dimethylpiperazin-2-yl)methyl]-5-iodo-6-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 115415776 |
| Molecular Formula | C14H24IN5 |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 2-[(1,4-dimethylpiperazin-2-yl)methyl]-5-iodo-6-propan-2-ylpyrimidin-4-amine |
| SMILES | CC(C)c1nc(CC2CN(C)CCN2C)nc(N)c1I |
| InChI | InChI=1S/C14H24IN5/c1-9(2)13-12(15)14(16)18-11(17-13)7-10-8-19(3)5-6-20(10)4/h9-10H,5-8H2,1-4H3,(H2,16,17,18) |
| InChIKey | RLXYKORXKZOHME-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|