6-[(3-amino-2,2-dimethylpropanoyl)amino]-4-ethylhexanoic acid

C13H26N2O3 — CID 113307665

IUPAC6-[(3-amino-2,2-dimethylpropanoyl)amino]-4-ethylhexanoic acid
SMILESCCC(CCNC(=O)C(C)(C)CN)CCC(=O)O
InChIInChI=1S/C13H26N2O3/c1-4-10(5-6-11(16)17)7-8-15-12(18)13(2,3)9-14/h10H,4-9,14H2,1-3H3,(H,15,18)(H,16,17)
InChIKeyAZHUMOBIROAQNZ-UHFFFAOYSA-N
MW258.36 g/mol
LogP1.37
Rot. Bonds9

About 6-[(3-amino-2,2-dimethylpropanoyl)amino]-4-ethylhexanoic acid

6-[(3-amino-2,2-dimethylpropanoyl)amino]-4-ethylhexanoic acid (PubChem CID 113307665) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is 6-[(3-amino-2,2-dimethylpropanoyl)amino]-4-ethylhexanoic acid.

Molecular Properties

Compound Name6-[(3-amino-2,2-dimethylpropanoyl)amino]-4-ethylhexanoic acid
PubChem CID113307665
Molecular FormulaC13H26N2O3
Molecular Weight258.36 g/mol
Exact Mass258.19
IUPAC Name6-[(3-amino-2,2-dimethylpropanoyl)amino]-4-ethylhexanoic acid
SMILESCCC(CCNC(=O)C(C)(C)CN)CCC(=O)O
InChIInChI=1S/C13H26N2O3/c1-4-10(5-6-11(16)17)7-8-15-12(18)13(2,3)9-14/h10H,4-9,14H2,1-3H3,(H,15,18)(H,16,17)
InChIKeyAZHUMOBIROAQNZ-UHFFFAOYSA-N
XLogP1.37
TPSA92.42 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.36
LogP ≤ 51.37
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 6-[(3-amino-2,2-dimethylpropanoyl)amino]-4-ethylhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-[(3-amino-2,2-dimethylpropanoyl)amino]-4-ethylhexanoic acid?
The IUPAC name of 6-[(3-amino-2,2-dimethylpropanoyl)amino]-4-ethylhexanoic acid (CID 113307665) is 6-[(3-amino-2,2-dimethylpropanoyl)amino]-4-ethylhexanoic acid.
What is the SMILES notation for 6-[(3-amino-2,2-dimethylpropanoyl)amino]-4-ethylhexanoic acid?
The canonical SMILES for 6-[(3-amino-2,2-dimethylpropanoyl)amino]-4-ethylhexanoic acid is CCC(CCNC(=O)C(C)(C)CN)CCC(=O)O.
What is the InChIKey of 6-[(3-amino-2,2-dimethylpropanoyl)amino]-4-ethylhexanoic acid?
The InChIKey is AZHUMOBIROAQNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O3/c1-4-10(5-6-11(16)17)7-8-15-12(18)13(2,3)9-14/h10H,4-9,14H2,1-3H3,(H,15,18)(H,16,17).
What are the key properties of 6-[(3-amino-2,2-dimethylpropanoyl)amino]-4-ethylhexanoic acid?
6-[(3-amino-2,2-dimethylpropanoyl)amino]-4-ethylhexanoic acid has a molecular weight of 258.36 g/mol, XLogP of 1.37, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3-amino-2,2-dimethylpropanoyl)amino]-4-ethylhexanoic acid is sourced from PubChem (CID 113307665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).