C13H26N2O3 — CID 113307665
6-[(3-amino-2,2-dimethylpropanoyl)amino]-4-ethylhexanoic acid (PubChem CID 113307665) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is 6-[(3-amino-2,2-dimethylpropanoyl)amino]-4-ethylhexanoic acid.
| Compound Name | 6-[(3-amino-2,2-dimethylpropanoyl)amino]-4-ethylhexanoic acid |
|---|---|
| PubChem CID | 113307665 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 6-[(3-amino-2,2-dimethylpropanoyl)amino]-4-ethylhexanoic acid |
| SMILES | CCC(CCNC(=O)C(C)(C)CN)CCC(=O)O |
| InChI | InChI=1S/C13H26N2O3/c1-4-10(5-6-11(16)17)7-8-15-12(18)13(2,3)9-14/h10H,4-9,14H2,1-3H3,(H,15,18)(H,16,17) |
| InChIKey | AZHUMOBIROAQNZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |