C35H42N4O3S — CID 11330856
2-[2-[4-[4-[(4-pentan-3-yl-N-propan-2-ylanilino)methyl]phenyl]-1,3-thiazol-2-yl]ethyl-(phenylcarbamoyl)amino]acetic acid (PubChem CID 11330856) has the molecular formula C35H42N4O3S and a molecular weight of 598.81 g/mol. Its IUPAC name is 2-[2-[4-[4-[(4-pentan-3-yl-N-propan-2-ylanilino)methyl]phenyl]-1,3-thiazol-2-yl]ethyl-(phenylcarbamoyl)amino]acetic acid.
| Compound Name | 2-[2-[4-[4-[(4-pentan-3-yl-N-propan-2-ylanilino)methyl]phenyl]-1,3-thiazol-2-yl]ethyl-(phenylcarbamoyl)amino]acetic acid |
|---|---|
| PubChem CID | 11330856 |
| Molecular Formula | C35H42N4O3S |
| Molecular Weight | 598.81 g/mol |
| Exact Mass | 598.30 |
| IUPAC Name | 2-[2-[4-[4-[(4-pentan-3-yl-N-propan-2-ylanilino)methyl]phenyl]-1,3-thiazol-2-yl]ethyl-(phenylcarbamoyl)amino]acetic acid |
| SMILES | CCC(CC)c1ccc(N(Cc2ccc(-c3csc(CCN(CC(=O)O)C(=O)Nc4ccccc4)n3)cc2)C(C)C)cc1 |
| InChI | InChI=1S/C35H42N4O3S/c1-5-27(6-2)28-16-18-31(19-17-28)39(25(3)4)22-26-12-14-29(15-13-26)32-24-43-33(37-32)20-21-38(23-34(40)41)35(42)36-30-10-8-7-9-11-30/h7-19,24-25,27H,5-6,20-23H2,1-4H3,(H,36,42)(H,40,41) |
| InChIKey | HPFRCMKIGTWRSP-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.81 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|