C13H15BrN2O2 — CID 113310255
[4-(7-bromo-1,3-benzoxazol-2-yl)oxan-4-yl]methanamine (PubChem CID 113310255) has the molecular formula C13H15BrN2O2 and a molecular weight of 311.18 g/mol. Its IUPAC name is [4-(7-bromo-1,3-benzoxazol-2-yl)oxan-4-yl]methanamine.
| Compound Name | [4-(7-bromo-1,3-benzoxazol-2-yl)oxan-4-yl]methanamine |
|---|---|
| PubChem CID | 113310255 |
| Molecular Formula | C13H15BrN2O2 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | [4-(7-bromo-1,3-benzoxazol-2-yl)oxan-4-yl]methanamine |
| SMILES | NCC1(c2nc3cccc(Br)c3o2)CCOCC1 |
| InChI | InChI=1S/C13H15BrN2O2/c14-9-2-1-3-10-11(9)18-12(16-10)13(8-15)4-6-17-7-5-13/h1-3H,4-8,15H2 |
| InChIKey | SSCONRLHPRNRTL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |