C8H4BrF2NO — CID 131119022
7-bromo-2-(difluoromethyl)-1,3-benzoxazole (PubChem CID 131119022) has the molecular formula C8H4BrF2NO and a molecular weight of 248.03 g/mol. Its IUPAC name is 7-bromo-2-(difluoromethyl)-1,3-benzoxazole.
| Compound Name | 7-bromo-2-(difluoromethyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 131119022 |
| Molecular Formula | C8H4BrF2NO |
| Molecular Weight | 248.03 g/mol |
| Exact Mass | 246.94 |
| IUPAC Name | 7-bromo-2-(difluoromethyl)-1,3-benzoxazole |
| SMILES | FC(F)c1nc2cccc(Br)c2o1 |
| InChI | InChI=1S/C8H4BrF2NO/c9-4-2-1-3-5-6(4)13-8(12-5)7(10)11/h1-3,7H |
| InChIKey | JYLQTPRRPNLFEI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.03 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |