C7H3BrClNO3S — CID 130925383
7-bromo-1,3-benzoxazole-2-sulfonyl chloride (PubChem CID 130925383) has the molecular formula C7H3BrClNO3S and a molecular weight of 296.53 g/mol. Its IUPAC name is 7-bromo-1,3-benzoxazole-2-sulfonyl chloride.
| Compound Name | 7-bromo-1,3-benzoxazole-2-sulfonyl chloride |
|---|---|
| PubChem CID | 130925383 |
| Molecular Formula | C7H3BrClNO3S |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 294.87 |
| IUPAC Name | 7-bromo-1,3-benzoxazole-2-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1nc2cccc(Br)c2o1 |
| InChI | InChI=1S/C7H3BrClNO3S/c8-4-2-1-3-5-6(4)13-7(10-5)14(9,11)12/h1-3H |
| InChIKey | NLCXCAFKZUPNTI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |