C7H3BrFNO — CID 131072299
7-bromo-2-fluoro-1,3-benzoxazole (PubChem CID 131072299) has the molecular formula C7H3BrFNO and a molecular weight of 216.01 g/mol. Its IUPAC name is 7-bromo-2-fluoro-1,3-benzoxazole.
| Compound Name | 7-bromo-2-fluoro-1,3-benzoxazole |
|---|---|
| PubChem CID | 131072299 |
| Molecular Formula | C7H3BrFNO |
| Molecular Weight | 216.01 g/mol |
| Exact Mass | 214.94 |
| IUPAC Name | 7-bromo-2-fluoro-1,3-benzoxazole |
| SMILES | Fc1nc2cccc(Br)c2o1 |
| InChI | InChI=1S/C7H3BrFNO/c8-4-2-1-3-5-6(4)11-7(9)10-5/h1-3H |
| InChIKey | OVEHPFMPSNHRIG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.01 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |