C9H6BrN3O — CID 130132782
2-amino-2-(7-bromo-1,3-benzoxazol-2-yl)acetonitrile (PubChem CID 130132782) has the molecular formula C9H6BrN3O and a molecular weight of 252.07 g/mol. Its IUPAC name is 2-amino-2-(7-bromo-1,3-benzoxazol-2-yl)acetonitrile.
| Compound Name | 2-amino-2-(7-bromo-1,3-benzoxazol-2-yl)acetonitrile |
|---|---|
| PubChem CID | 130132782 |
| Molecular Formula | C9H6BrN3O |
| Molecular Weight | 252.07 g/mol |
| Exact Mass | 250.97 |
| IUPAC Name | 2-amino-2-(7-bromo-1,3-benzoxazol-2-yl)acetonitrile |
| SMILES | N#CC(N)c1nc2cccc(Br)c2o1 |
| InChI | InChI=1S/C9H6BrN3O/c10-5-2-1-3-7-8(5)14-9(13-7)6(12)4-11/h1-3,6H,12H2 |
| InChIKey | DRPOREGNFDCAAC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.07 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |