C11H19N5O2 — CID 113310410
4-methyl-1-[[(1-methyltetrazol-5-yl)amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 113310410) has the molecular formula C11H19N5O2 and a molecular weight of 253.31 g/mol. Its IUPAC name is 4-methyl-1-[[(1-methyltetrazol-5-yl)amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-methyl-1-[[(1-methyltetrazol-5-yl)amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 113310410 |
| Molecular Formula | C11H19N5O2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 4-methyl-1-[[(1-methyltetrazol-5-yl)amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | CC1CCC(CNc2nnnn2C)(C(=O)O)CC1 |
| InChI | InChI=1S/C11H19N5O2/c1-8-3-5-11(6-4-8,9(17)18)7-12-10-13-14-15-16(10)2/h8H,3-7H2,1-2H3,(H,17,18)(H,12,13,15) |
| InChIKey | VEDBNGTWVXVESB-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |