C28H29BF6N2O5S2 — CID 11331295
(3aS)-3,3-diphenyl-1-(2-propan-2-ylphenyl)-4,5,6,7-tetrahydro-3aH-pyrrolo[1,2-c][1,3,2]oxazaborol-7-ium;bis(trifluoromethylsulfonyl)azanide (PubChem CID 11331295) has the molecular formula C28H29BF6N2O5S2 and a molecular weight of 662.48 g/mol. Its IUPAC name is (3aS)-3,3-diphenyl-1-(2-propan-2-ylphenyl)-4,5,6,7-tetrahydro-3aH-pyrrolo[1,2-c][1,3,2]oxazaborol-7-ium;bis(trifluoromethylsulfonyl)azanide.
| Compound Name | (3aS)-3,3-diphenyl-1-(2-propan-2-ylphenyl)-4,5,6,7-tetrahydro-3aH-pyrrolo[1,2-c][1,3,2]oxazaborol-7-ium;bis(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 11331295 |
| Molecular Formula | C28H29BF6N2O5S2 |
| Molecular Weight | 662.48 g/mol |
| Exact Mass | 662.15 |
| IUPAC Name | (3aS)-3,3-diphenyl-1-(2-propan-2-ylphenyl)-4,5,6,7-tetrahydro-3aH-pyrrolo[1,2-c][1,3,2]oxazaborol-7-ium;bis(trifluoromethylsulfonyl)azanide |
| SMILES | CC(C)c1ccccc1B1OC(c2ccccc2)(c2ccccc2)[C@@H]2CCC[NH+]12.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C26H28BNO.C2F6NO4S2/c1-20(2)23-16-9-10-17-24(23)27-28-19-11-18-25(28)26(29-27,21-12-5-3-6-13-21)22-14-7-4-8-15-22;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3-10,12-17,20,25H,11,18-19H2,1-2H3;/q;-1/p+1/t25-;/m0./s1 |
| InChIKey | JMDRWPSDEVCONQ-UQIIZPHYSA-O |
| XLogP | 4.59 |
| TPSA | 96.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|