C39H56O10 — CID 11331401
3-[(4S,6R)-6-[(2S)-2,4-bis(phenylmethoxy)butyl]-2,2-dimethyl-1,3-dioxan-4-yl]-1-[(7R,9R)-7-(methoxymethoxymethyl)-1,4,8-trioxaspiro[4.5]decan-9-yl]-3-methylbutan-2-one (PubChem CID 11331401) has the molecular formula C39H56O10 and a molecular weight of 684.87 g/mol. Its IUPAC name is 3-[(4S,6R)-6-[(2S)-2,4-bis(phenylmethoxy)butyl]-2,2-dimethyl-1,3-dioxan-4-yl]-1-[(7R,9R)-7-(methoxymethoxymethyl)-1,4,8-trioxaspiro[4.5]decan-9-yl]-3-methylbutan-2-one.
| Compound Name | 3-[(4S,6R)-6-[(2S)-2,4-bis(phenylmethoxy)butyl]-2,2-dimethyl-1,3-dioxan-4-yl]-1-[(7R,9R)-7-(methoxymethoxymethyl)-1,4,8-trioxaspiro[4.5]decan-9-yl]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 11331401 |
| Molecular Formula | C39H56O10 |
| Molecular Weight | 684.87 g/mol |
| Exact Mass | 684.39 |
| IUPAC Name | 3-[(4S,6R)-6-[(2S)-2,4-bis(phenylmethoxy)butyl]-2,2-dimethyl-1,3-dioxan-4-yl]-1-[(7R,9R)-7-(methoxymethoxymethyl)-1,4,8-trioxaspiro[4.5]decan-9-yl]-3-methylbutan-2-one |
| SMILES | COCOC[C@H]1CC2(C[C@@H](CC(=O)C(C)(C)[C@@H]3C[C@@H](C[C@H](CCOCc4ccccc4)OCc4ccccc4)OC(C)(C)O3)O1)OCCO2 |
| InChI | InChI=1S/C39H56O10/c1-37(2,35(40)21-33-23-39(45-18-19-46-39)24-34(47-33)27-43-28-41-5)36-22-32(48-38(3,4)49-36)20-31(44-26-30-14-10-7-11-15-30)16-17-42-25-29-12-8-6-9-13-29/h6-15,31-34,36H,16-28H2,1-5H3/t31-,32+,33+,34+,36-/m0/s1 |
| InChIKey | DUKWXWHBYJWTLJ-ZGBZMILWSA-N |
| XLogP | 6.38 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.87 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|