C26H40O6 — CID 134938106
tert-butyl 3-[(5aS,6S,8S,9aR)-2,2,5a-trimethyl-8-(phenylmethoxymethyl)-4,5,6,8,9,9a-hexahydropyrano[4,3-d][1,3]dioxepin-6-yl]propanoate (PubChem CID 134938106) has the molecular formula C26H40O6 and a molecular weight of 448.60 g/mol. Its IUPAC name is tert-butyl 3-[(5aS,6S,8S,9aR)-2,2,5a-trimethyl-8-(phenylmethoxymethyl)-4,5,6,8,9,9a-hexahydropyrano[4,3-d][1,3]dioxepin-6-yl]propanoate.
| Compound Name | tert-butyl 3-[(5aS,6S,8S,9aR)-2,2,5a-trimethyl-8-(phenylmethoxymethyl)-4,5,6,8,9,9a-hexahydropyrano[4,3-d][1,3]dioxepin-6-yl]propanoate |
|---|---|
| PubChem CID | 134938106 |
| Molecular Formula | C26H40O6 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | tert-butyl 3-[(5aS,6S,8S,9aR)-2,2,5a-trimethyl-8-(phenylmethoxymethyl)-4,5,6,8,9,9a-hexahydropyrano[4,3-d][1,3]dioxepin-6-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)CC[C@@H]1O[C@H](COCc2ccccc2)C[C@H]2OC(C)(C)OCC[C@@]12C |
| InChI | InChI=1S/C26H40O6/c1-24(2,3)32-23(27)13-12-21-26(6)14-15-29-25(4,5)31-22(26)16-20(30-21)18-28-17-19-10-8-7-9-11-19/h7-11,20-22H,12-18H2,1-6H3/t20-,21-,22+,26-/m0/s1 |
| InChIKey | UXIVRSQYBMBTKF-IFOBJOEFSA-N |
| XLogP | 5.03 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |