C19H25LiO5 — CID 101046817
lithium (Z)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-5-[(2S,3R)-3-(phenylmethoxymethyl)oxiran-2-yl]pent-2-en-3-olate (PubChem CID 101046817) has the molecular formula C19H25LiO5 and a molecular weight of 340.34 g/mol. Its IUPAC name is lithium (Z)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-5-[(2S,3R)-3-(phenylmethoxymethyl)oxiran-2-yl]pent-2-en-3-olate.
| Compound Name | lithium (Z)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-5-[(2S,3R)-3-(phenylmethoxymethyl)oxiran-2-yl]pent-2-en-3-olate |
|---|---|
| PubChem CID | 101046817 |
| Molecular Formula | C19H25LiO5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | lithium (Z)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-5-[(2S,3R)-3-(phenylmethoxymethyl)oxiran-2-yl]pent-2-en-3-olate |
| SMILES | CC(C)(C)OC(=O)/C=C(\[O-])CC[C@@H]1O[C@@H]1COCc1ccccc1.[Li+] |
| InChI | InChI=1S/C19H26O5.Li/c1-19(2,3)24-18(21)11-15(20)9-10-16-17(23-16)13-22-12-14-7-5-4-6-8-14;/h4-8,11,16-17,20H,9-10,12-13H2,1-3H3;/q;+1/p-1/b15-11-;/t16-,17+;/m0./s1 |
| InChIKey | VDLVIIVDXJFXFP-CEAIDOTCSA-M |
| XLogP | -0.66 |
| TPSA | 71.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|