C14H17ClFN — CID 113321743
1-(2-chloro-4-fluorophenyl)-N-[(1-cyclopropylcyclopropyl)methyl]methanamine (PubChem CID 113321743) has the molecular formula C14H17ClFN and a molecular weight of 253.75 g/mol. Its IUPAC name is 1-(2-chloro-4-fluorophenyl)-N-[(1-cyclopropylcyclopropyl)methyl]methanamine.
| Compound Name | 1-(2-chloro-4-fluorophenyl)-N-[(1-cyclopropylcyclopropyl)methyl]methanamine |
|---|---|
| PubChem CID | 113321743 |
| Molecular Formula | C14H17ClFN |
| Molecular Weight | 253.75 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 1-(2-chloro-4-fluorophenyl)-N-[(1-cyclopropylcyclopropyl)methyl]methanamine |
| SMILES | Fc1ccc(CNCC2(C3CC3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C14H17ClFN/c15-13-7-12(16)4-1-10(13)8-17-9-14(5-6-14)11-2-3-11/h1,4,7,11,17H,2-3,5-6,8-9H2 |
| InChIKey | MTKMHQOULPXDJD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.75 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |