C15H17F4N — CID 103838628
N-[(1-cyclopropylcyclopropyl)methyl]-1-[3-fluoro-5-(trifluoromethyl)phenyl]methanamine (PubChem CID 103838628) has the molecular formula C15H17F4N and a molecular weight of 287.30 g/mol. Its IUPAC name is N-[(1-cyclopropylcyclopropyl)methyl]-1-[3-fluoro-5-(trifluoromethyl)phenyl]methanamine.
| Compound Name | N-[(1-cyclopropylcyclopropyl)methyl]-1-[3-fluoro-5-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 103838628 |
| Molecular Formula | C15H17F4N |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | N-[(1-cyclopropylcyclopropyl)methyl]-1-[3-fluoro-5-(trifluoromethyl)phenyl]methanamine |
| SMILES | Fc1cc(CNCC2(C3CC3)CC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H17F4N/c16-13-6-10(5-12(7-13)15(17,18)19)8-20-9-14(3-4-14)11-1-2-11/h5-7,11,20H,1-4,8-9H2 |
| InChIKey | XHHUMFGEEONHIM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |