C16H21F4N — CID 115350673
N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-methylcycloheptan-1-amine (PubChem CID 115350673) has the molecular formula C16H21F4N and a molecular weight of 303.34 g/mol. Its IUPAC name is N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-methylcycloheptan-1-amine.
| Compound Name | N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-methylcycloheptan-1-amine |
|---|---|
| PubChem CID | 115350673 |
| Molecular Formula | C16H21F4N |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-methylcycloheptan-1-amine |
| SMILES | CC1CCCCCC1NCc1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H21F4N/c1-11-5-3-2-4-6-15(11)21-10-12-7-13(16(18,19)20)9-14(17)8-12/h7-9,11,15,21H,2-6,10H2,1H3 |
| InChIKey | JENUJSGRYBFAAU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |