C15H19F4NO — CID 115282883
2-[[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]methyl]cyclohexan-1-ol (PubChem CID 115282883) has the molecular formula C15H19F4NO and a molecular weight of 305.31 g/mol. Its IUPAC name is 2-[[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]methyl]cyclohexan-1-ol.
| Compound Name | 2-[[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 115282883 |
| Molecular Formula | C15H19F4NO |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-[[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]methyl]cyclohexan-1-ol |
| SMILES | OC1CCCCC1CNCc1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H19F4NO/c16-13-6-10(5-12(7-13)15(17,18)19)8-20-9-11-3-1-2-4-14(11)21/h5-7,11,14,20-21H,1-4,8-9H2 |
| InChIKey | IMWGHDMKLQDIRV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |