C15H18F4N2 — CID 115350227
N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-1-azabicyclo[2.2.2]octan-3-amine (PubChem CID 115350227) has the molecular formula C15H18F4N2 and a molecular weight of 302.31 g/mol. Its IUPAC name is N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-1-azabicyclo[2.2.2]octan-3-amine.
| Compound Name | N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-1-azabicyclo[2.2.2]octan-3-amine |
|---|---|
| PubChem CID | 115350227 |
| Molecular Formula | C15H18F4N2 |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-1-azabicyclo[2.2.2]octan-3-amine |
| SMILES | Fc1cc(CNC2CN3CCC2CC3)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H18F4N2/c16-13-6-10(5-12(7-13)15(17,18)19)8-20-14-9-21-3-1-11(14)2-4-21/h5-7,11,14,20H,1-4,8-9H2 |
| InChIKey | GYJQGFXDBLGLTG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |