C13H14F4N2O — CID 115282854
5-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]piperidin-2-one (PubChem CID 115282854) has the molecular formula C13H14F4N2O and a molecular weight of 290.26 g/mol. Its IUPAC name is 5-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]piperidin-2-one.
| Compound Name | 5-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]piperidin-2-one |
|---|---|
| PubChem CID | 115282854 |
| Molecular Formula | C13H14F4N2O |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 5-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]piperidin-2-one |
| SMILES | O=C1CCC(NCc2cc(F)cc(C(F)(F)F)c2)CN1 |
| InChI | InChI=1S/C13H14F4N2O/c14-10-4-8(3-9(5-10)13(15,16)17)6-18-11-1-2-12(20)19-7-11/h3-5,11,18H,1-2,6-7H2,(H,19,20) |
| InChIKey | WMTJFMKGJYFVGS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |