C14H17F4NO — CID 115282901
[1-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]cyclopentyl]methanol (PubChem CID 115282901) has the molecular formula C14H17F4NO and a molecular weight of 291.29 g/mol. Its IUPAC name is [1-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]cyclopentyl]methanol.
| Compound Name | [1-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 115282901 |
| Molecular Formula | C14H17F4NO |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | [1-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]cyclopentyl]methanol |
| SMILES | OCC1(NCc2cc(F)cc(C(F)(F)F)c2)CCCC1 |
| InChI | InChI=1S/C14H17F4NO/c15-12-6-10(5-11(7-12)14(16,17)18)8-19-13(9-20)3-1-2-4-13/h5-7,19-20H,1-4,8-9H2 |
| InChIKey | GPODKMRYFHAEQU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |