C12H14F2N4 — CID 113325375
2-(3,5-diethyl-1,2,4-triazol-1-yl)-4,6-difluoroaniline (PubChem CID 113325375) has the molecular formula C12H14F2N4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-(3,5-diethyl-1,2,4-triazol-1-yl)-4,6-difluoroaniline.
| Compound Name | 2-(3,5-diethyl-1,2,4-triazol-1-yl)-4,6-difluoroaniline |
|---|---|
| PubChem CID | 113325375 |
| Molecular Formula | C12H14F2N4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2-(3,5-diethyl-1,2,4-triazol-1-yl)-4,6-difluoroaniline |
| SMILES | CCc1nc(CC)n(-c2cc(F)cc(F)c2N)n1 |
| InChI | InChI=1S/C12H14F2N4/c1-3-10-16-11(4-2)18(17-10)9-6-7(13)5-8(14)12(9)15/h5-6H,3-4,15H2,1-2H3 |
| InChIKey | OQEGOFMLDLYMSI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|