C13H16FN3O — CID 114065334
[2-(3,5-diethyl-1,2,4-triazol-1-yl)-6-fluorophenyl]methanol (PubChem CID 114065334) has the molecular formula C13H16FN3O and a molecular weight of 249.29 g/mol. Its IUPAC name is [2-(3,5-diethyl-1,2,4-triazol-1-yl)-6-fluorophenyl]methanol.
| Compound Name | [2-(3,5-diethyl-1,2,4-triazol-1-yl)-6-fluorophenyl]methanol |
|---|---|
| PubChem CID | 114065334 |
| Molecular Formula | C13H16FN3O |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | [2-(3,5-diethyl-1,2,4-triazol-1-yl)-6-fluorophenyl]methanol |
| SMILES | CCc1nc(CC)n(-c2cccc(F)c2CO)n1 |
| InChI | InChI=1S/C13H16FN3O/c1-3-12-15-13(4-2)17(16-12)11-7-5-6-10(14)9(11)8-18/h5-7,18H,3-4,8H2,1-2H3 |
| InChIKey | FOYLGHCAVSESHX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |