C13H14F3NO2 — CID 113326496
1-(4,4,4-trifluorobutyl)-7,8-dihydro-6H-quinoline-2,5-dione (PubChem CID 113326496) has the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. Its IUPAC name is 1-(4,4,4-trifluorobutyl)-7,8-dihydro-6H-quinoline-2,5-dione.
| Compound Name | 1-(4,4,4-trifluorobutyl)-7,8-dihydro-6H-quinoline-2,5-dione |
|---|---|
| PubChem CID | 113326496 |
| Molecular Formula | C13H14F3NO2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 1-(4,4,4-trifluorobutyl)-7,8-dihydro-6H-quinoline-2,5-dione |
| SMILES | O=C1CCCc2c1ccc(=O)n2CCCC(F)(F)F |
| InChI | InChI=1S/C13H14F3NO2/c14-13(15,16)7-2-8-17-10-3-1-4-11(18)9(10)5-6-12(17)19/h5-6H,1-4,7-8H2 |
| InChIKey | JAPIZBXZCXLTOE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |