C11H18F3NO2 — CID 113326565
4-(4,4,4-trifluorobutylamino)cyclohexane-1-carboxylic acid (PubChem CID 113326565) has the molecular formula C11H18F3NO2 and a molecular weight of 253.26 g/mol. Its IUPAC name is 4-(4,4,4-trifluorobutylamino)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(4,4,4-trifluorobutylamino)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 113326565 |
| Molecular Formula | C11H18F3NO2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 4-(4,4,4-trifluorobutylamino)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NCCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H18F3NO2/c12-11(13,14)6-1-7-15-9-4-2-8(3-5-9)10(16)17/h8-9,15H,1-7H2,(H,16,17) |
| InChIKey | NGWBCTRVLLUOET-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|