C8H8ClF3N2O4S — CID 113327218
2,4-dioxo-1-(4,4,4-trifluorobutyl)pyrimidine-5-sulfonyl chloride (PubChem CID 113327218) has the molecular formula C8H8ClF3N2O4S and a molecular weight of 320.68 g/mol. Its IUPAC name is 2,4-dioxo-1-(4,4,4-trifluorobutyl)pyrimidine-5-sulfonyl chloride.
| Compound Name | 2,4-dioxo-1-(4,4,4-trifluorobutyl)pyrimidine-5-sulfonyl chloride |
|---|---|
| PubChem CID | 113327218 |
| Molecular Formula | C8H8ClF3N2O4S |
| Molecular Weight | 320.68 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | 2,4-dioxo-1-(4,4,4-trifluorobutyl)pyrimidine-5-sulfonyl chloride |
| SMILES | O=c1[nH]c(=O)n(CCCC(F)(F)F)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C8H8ClF3N2O4S/c9-19(17,18)5-4-14(7(16)13-6(5)15)3-1-2-8(10,11)12/h4H,1-3H2,(H,13,15,16) |
| InChIKey | DAESJHMKAOFERY-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.68 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |