C10H15ClN2O6S2 — CID 106728510
1-(2-tert-butylsulfonylethyl)-2,4-dioxopyrimidine-5-sulfonyl chloride (PubChem CID 106728510) has the molecular formula C10H15ClN2O6S2 and a molecular weight of 358.83 g/mol. Its IUPAC name is 1-(2-tert-butylsulfonylethyl)-2,4-dioxopyrimidine-5-sulfonyl chloride.
| Compound Name | 1-(2-tert-butylsulfonylethyl)-2,4-dioxopyrimidine-5-sulfonyl chloride |
|---|---|
| PubChem CID | 106728510 |
| Molecular Formula | C10H15ClN2O6S2 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | 1-(2-tert-butylsulfonylethyl)-2,4-dioxopyrimidine-5-sulfonyl chloride |
| SMILES | CC(C)(C)S(=O)(=O)CCn1cc(S(=O)(=O)Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15ClN2O6S2/c1-10(2,3)20(16,17)5-4-13-6-7(21(11,18)19)8(14)12-9(13)15/h6H,4-5H2,1-3H3,(H,12,14,15) |
| InChIKey | NKGLZXSGAAZZIB-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |