C8H8F3IN2O2 — CID 115519719
5-iodo-1-(4,4,4-trifluorobutyl)pyrimidine-2,4-dione (PubChem CID 115519719) has the molecular formula C8H8F3IN2O2 and a molecular weight of 348.06 g/mol. Its IUPAC name is 5-iodo-1-(4,4,4-trifluorobutyl)pyrimidine-2,4-dione.
| Compound Name | 5-iodo-1-(4,4,4-trifluorobutyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 115519719 |
| Molecular Formula | C8H8F3IN2O2 |
| Molecular Weight | 348.06 g/mol |
| Exact Mass | 347.96 |
| IUPAC Name | 5-iodo-1-(4,4,4-trifluorobutyl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(CCCC(F)(F)F)cc1I |
| InChI | InChI=1S/C8H8F3IN2O2/c9-8(10,11)2-1-3-14-4-5(12)6(15)13-7(14)16/h4H,1-3H2,(H,13,15,16) |
| InChIKey | NULGFXOBXPEDNX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.06 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|