C8H11IN2O4 — CID 58979936
1-(3,4-dihydroxybutyl)-5-iodopyrimidine-2,4-dione (PubChem CID 58979936) has the molecular formula C8H11IN2O4 and a molecular weight of 326.09 g/mol. Its IUPAC name is 1-(3,4-dihydroxybutyl)-5-iodopyrimidine-2,4-dione.
| Compound Name | 1-(3,4-dihydroxybutyl)-5-iodopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58979936 |
| Molecular Formula | C8H11IN2O4 |
| Molecular Weight | 326.09 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | 1-(3,4-dihydroxybutyl)-5-iodopyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(CCC(O)CO)cc1I |
| InChI | InChI=1S/C8H11IN2O4/c9-6-3-11(2-1-5(13)4-12)8(15)10-7(6)14/h3,5,12-13H,1-2,4H2,(H,10,14,15) |
| InChIKey | WIKAAIRZFYKYFC-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.09 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|