C9H13IN2O3 — CID 131007523
5-iodo-1-(2-methoxy-2-methylpropyl)pyrimidine-2,4-dione (PubChem CID 131007523) has the molecular formula C9H13IN2O3 and a molecular weight of 324.12 g/mol. Its IUPAC name is 5-iodo-1-(2-methoxy-2-methylpropyl)pyrimidine-2,4-dione.
| Compound Name | 5-iodo-1-(2-methoxy-2-methylpropyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 131007523 |
| Molecular Formula | C9H13IN2O3 |
| Molecular Weight | 324.12 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 5-iodo-1-(2-methoxy-2-methylpropyl)pyrimidine-2,4-dione |
| SMILES | COC(C)(C)Cn1cc(I)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H13IN2O3/c1-9(2,15-3)5-12-4-6(10)7(13)11-8(12)14/h4H,5H2,1-3H3,(H,11,13,14) |
| InChIKey | XCATWRFEBPCGTE-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.12 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|