C12H22O — CID 11332854
3-[(1S,2R,4R)-2-ethyl-4-prop-2-enylcyclobutyl]propan-1-ol (PubChem CID 11332854) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is 3-[(1S,2R,4R)-2-ethyl-4-prop-2-enylcyclobutyl]propan-1-ol.
| Compound Name | 3-[(1S,2R,4R)-2-ethyl-4-prop-2-enylcyclobutyl]propan-1-ol |
|---|---|
| PubChem CID | 11332854 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 3-[(1S,2R,4R)-2-ethyl-4-prop-2-enylcyclobutyl]propan-1-ol |
| SMILES | C=CC[C@@H]1C[C@@H](CC)[C@@H]1CCCO |
| InChI | InChI=1S/C12H22O/c1-3-6-11-9-10(4-2)12(11)7-5-8-13/h3,10-13H,1,4-9H2,2H3/t10-,11-,12+/m1/s1 |
| InChIKey | JOMUBLPTASOFFO-UTUOFQBUSA-N |
| XLogP | 3.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|