C18H31N — CID 101233333
(1S,3R,7R,8S,10S)-8-ethyl-3-prop-2-enyl-10-propyl-11-azatricyclo[5.3.1.04,11]undecane (PubChem CID 101233333) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is (1S,3R,7R,8S,10S)-8-ethyl-3-prop-2-enyl-10-propyl-11-azatricyclo[5.3.1.04,11]undecane.
| Compound Name | (1S,3R,7R,8S,10S)-8-ethyl-3-prop-2-enyl-10-propyl-11-azatricyclo[5.3.1.04,11]undecane |
|---|---|
| PubChem CID | 101233333 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | (1S,3R,7R,8S,10S)-8-ethyl-3-prop-2-enyl-10-propyl-11-azatricyclo[5.3.1.04,11]undecane |
| SMILES | C=CC[C@@H]1C[C@H]2[C@@H](CCC)C[C@H](CC)[C@H]3CCC1N32 |
| InChI | InChI=1S/C18H31N/c1-4-7-14-11-13(6-3)16-9-10-17-15(8-5-2)12-18(14)19(16)17/h5,13-18H,2,4,6-12H2,1,3H3/t13-,14-,15+,16+,17?,18-/m0/s1 |
| InChIKey | PQFMGMYNYSDPDW-PNSRCHHHSA-N |
| XLogP | 4.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|