C12H18O2 — CID 11333029
3-ethenyl-8,8-dimethyl-7,9-dioxaspiro[4.5]dec-2-ene (PubChem CID 11333029) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 3-ethenyl-8,8-dimethyl-7,9-dioxaspiro[4.5]dec-2-ene.
| Compound Name | 3-ethenyl-8,8-dimethyl-7,9-dioxaspiro[4.5]dec-2-ene |
|---|---|
| PubChem CID | 11333029 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 3-ethenyl-8,8-dimethyl-7,9-dioxaspiro[4.5]dec-2-ene |
| SMILES | C=CC1=CCC2(COC(C)(C)OC2)C1 |
| InChI | InChI=1S/C12H18O2/c1-4-10-5-6-12(7-10)8-13-11(2,3)14-9-12/h4-5H,1,6-9H2,2-3H3 |
| InChIKey | RWJLCPKJOKROSN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |