C13H22O2 — CID 20307638
3-Butyl-2,4-dioxaspiro[5.5]undec-9-ene (PubChem CID 20307638) has the molecular formula C13H22O2 and a molecular weight of 210.31 g/mol. Its IUPAC name is 3-butyl-2,4-dioxaspiro[5.5]undec-9-ene.
| Compound Name | 3-Butyl-2,4-dioxaspiro[5.5]undec-9-ene |
|---|---|
| PubChem CID | 20307638 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.31 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 3-butyl-2,4-dioxaspiro[5.5]undec-9-ene |
| SMILES | CCCCC1OCC2(CCC=CC2)CO1 |
| InChI | InChI=1S/C13H22O2/c1-2-3-7-12-14-10-13(11-15-12)8-5-4-6-9-13/h4-5,12H,2-3,6-11H2,1H3 |
| InChIKey | DYHHIFUDBGCNKW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 18.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | 215 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|