(2R)-2-acetamido-3-(1,2,4-triazol-1-yl)propanoic acid

C7H10N4O3 — CID 11333078

IUPAC(2R)-2-acetamido-3-(1,2,4-triazol-1-yl)propanoic acid
SMILESCC(=O)N[C@H](Cn1cncn1)C(=O)O
InChIInChI=1S/C7H10N4O3/c1-5(12)10-6(7(13)14)2-11-4-8-3-9-11/h3-4,6H,2H2,1H3,(H,10,12)(H,13,14)/t6-/m1/s1
InChIKeyZZEGRAFQYKBJCX-ZCFIWIBFSA-N
MW198.18 g/mol
LogP-1.13
Rot. Bonds4

About (2R)-2-acetamido-3-(1,2,4-triazol-1-yl)propanoic acid

(2R)-2-acetamido-3-(1,2,4-triazol-1-yl)propanoic acid (PubChem CID 11333078) has the molecular formula C7H10N4O3 and a molecular weight of 198.18 g/mol. Its IUPAC name is (2R)-2-acetamido-3-(1,2,4-triazol-1-yl)propanoic acid.

Molecular Properties

Compound Name(2R)-2-acetamido-3-(1,2,4-triazol-1-yl)propanoic acid
PubChem CID11333078
Molecular FormulaC7H10N4O3
Molecular Weight198.18 g/mol
Exact Mass198.08
IUPAC Name(2R)-2-acetamido-3-(1,2,4-triazol-1-yl)propanoic acid
SMILESCC(=O)N[C@H](Cn1cncn1)C(=O)O
InChIInChI=1S/C7H10N4O3/c1-5(12)10-6(7(13)14)2-11-4-8-3-9-11/h3-4,6H,2H2,1H3,(H,10,12)(H,13,14)/t6-/m1/s1
InChIKeyZZEGRAFQYKBJCX-ZCFIWIBFSA-N
XLogP-1.13
TPSA97.11 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.18
LogP ≤ 5-1.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze (2R)-2-acetamido-3-(1,2,4-triazol-1-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-acetamido-3-(1,2,4-triazol-1-yl)propanoic acid?
The IUPAC name of (2R)-2-acetamido-3-(1,2,4-triazol-1-yl)propanoic acid (CID 11333078) is (2R)-2-acetamido-3-(1,2,4-triazol-1-yl)propanoic acid.
What is the SMILES notation for (2R)-2-acetamido-3-(1,2,4-triazol-1-yl)propanoic acid?
The canonical SMILES for (2R)-2-acetamido-3-(1,2,4-triazol-1-yl)propanoic acid is CC(=O)N[C@H](Cn1cncn1)C(=O)O.
What is the InChIKey of (2R)-2-acetamido-3-(1,2,4-triazol-1-yl)propanoic acid?
The InChIKey is ZZEGRAFQYKBJCX-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H10N4O3/c1-5(12)10-6(7(13)14)2-11-4-8-3-9-11/h3-4,6H,2H2,1H3,(H,10,12)(H,13,14)/t6-/m1/s1.
What are the key properties of (2R)-2-acetamido-3-(1,2,4-triazol-1-yl)propanoic acid?
(2R)-2-acetamido-3-(1,2,4-triazol-1-yl)propanoic acid has a molecular weight of 198.18 g/mol, XLogP of -1.13, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-acetamido-3-(1,2,4-triazol-1-yl)propanoic acid is sourced from PubChem (CID 11333078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).