C11H11Cl2NO2S2 — CID 113334782
2,5-dichloro-N-(cyclopropylmethyl)-N-prop-2-ynylthiophene-3-sulfonamide (PubChem CID 113334782) has the molecular formula C11H11Cl2NO2S2 and a molecular weight of 324.25 g/mol. Its IUPAC name is 2,5-dichloro-N-(cyclopropylmethyl)-N-prop-2-ynylthiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-(cyclopropylmethyl)-N-prop-2-ynylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 113334782 |
| Molecular Formula | C11H11Cl2NO2S2 |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 322.96 |
| IUPAC Name | 2,5-dichloro-N-(cyclopropylmethyl)-N-prop-2-ynylthiophene-3-sulfonamide |
| SMILES | C#CCN(CC1CC1)S(=O)(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H11Cl2NO2S2/c1-2-5-14(7-8-3-4-8)18(15,16)9-6-10(12)17-11(9)13/h1,6,8H,3-5,7H2 |
| InChIKey | BTEFDDJNUSZLGB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|