C13H15NO2S — CID 80965589
N-(cyclopropylmethyl)-N-prop-2-ynylbenzenesulfonamide (PubChem CID 80965589) has the molecular formula C13H15NO2S and a molecular weight of 249.34 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-prop-2-ynylbenzenesulfonamide.
| Compound Name | N-(cyclopropylmethyl)-N-prop-2-ynylbenzenesulfonamide |
|---|---|
| PubChem CID | 80965589 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | N-(cyclopropylmethyl)-N-prop-2-ynylbenzenesulfonamide |
| SMILES | C#CCN(CC1CC1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H15NO2S/c1-2-10-14(11-12-8-9-12)17(15,16)13-6-4-3-5-7-13/h1,3-7,12H,8-11H2 |
| InChIKey | UBDOMTPOIZCUNZ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|