C14H16FNO2S — CID 115556481
N-(cyclopropylmethyl)-5-fluoro-2-methyl-N-prop-2-ynylbenzenesulfonamide (PubChem CID 115556481) has the molecular formula C14H16FNO2S and a molecular weight of 281.35 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-5-fluoro-2-methyl-N-prop-2-ynylbenzenesulfonamide.
| Compound Name | N-(cyclopropylmethyl)-5-fluoro-2-methyl-N-prop-2-ynylbenzenesulfonamide |
|---|---|
| PubChem CID | 115556481 |
| Molecular Formula | C14H16FNO2S |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | N-(cyclopropylmethyl)-5-fluoro-2-methyl-N-prop-2-ynylbenzenesulfonamide |
| SMILES | C#CCN(CC1CC1)S(=O)(=O)c1cc(F)ccc1C |
| InChI | InChI=1S/C14H16FNO2S/c1-3-8-16(10-12-5-6-12)19(17,18)14-9-13(15)7-4-11(14)2/h1,4,7,9,12H,5-6,8,10H2,2H3 |
| InChIKey | DQPYPWSMPVZMAO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|