C11H20N2O2S — CID 114812579
[tert-butylsulfamoyl(prop-2-ynyl)amino]methylcyclopropane (PubChem CID 114812579) has the molecular formula C11H20N2O2S and a molecular weight of 244.36 g/mol. Its IUPAC name is [tert-butylsulfamoyl(prop-2-ynyl)amino]methylcyclopropane.
| Compound Name | [tert-butylsulfamoyl(prop-2-ynyl)amino]methylcyclopropane |
|---|---|
| PubChem CID | 114812579 |
| Molecular Formula | C11H20N2O2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | [tert-butylsulfamoyl(prop-2-ynyl)amino]methylcyclopropane |
| SMILES | C#CCN(CC1CC1)S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H20N2O2S/c1-5-8-13(9-10-6-7-10)16(14,15)12-11(2,3)4/h1,10,12H,6-9H2,2-4H3 |
| InChIKey | IZBWAFHQYHPFNN-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|