C16H20FNO3S — CID 167964826
N-(cyclopropylmethyl)-2-(4-fluorophenyl)-2-methoxy-N-prop-2-ynylethanesulfonamide (PubChem CID 167964826) has the molecular formula C16H20FNO3S and a molecular weight of 325.40 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-(4-fluorophenyl)-2-methoxy-N-prop-2-ynylethanesulfonamide.
| Compound Name | N-(cyclopropylmethyl)-2-(4-fluorophenyl)-2-methoxy-N-prop-2-ynylethanesulfonamide |
|---|---|
| PubChem CID | 167964826 |
| Molecular Formula | C16H20FNO3S |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-(cyclopropylmethyl)-2-(4-fluorophenyl)-2-methoxy-N-prop-2-ynylethanesulfonamide |
| SMILES | C#CCN(CC1CC1)S(=O)(=O)CC(OC)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H20FNO3S/c1-3-10-18(11-13-4-5-13)22(19,20)12-16(21-2)14-6-8-15(17)9-7-14/h1,6-9,13,16H,4-5,10-12H2,2H3 |
| InChIKey | KMXZFAZPTDHKKJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|