C22H28N2O2S — CID 71050438
N-benzyl-N-(cyclopropylmethyl)-4-(pyrrolidin-1-ylmethyl)benzenesulfonamide (PubChem CID 71050438) has the molecular formula C22H28N2O2S and a molecular weight of 384.54 g/mol. Its IUPAC name is N-benzyl-N-(cyclopropylmethyl)-4-(pyrrolidin-1-ylmethyl)benzenesulfonamide.
| Compound Name | N-benzyl-N-(cyclopropylmethyl)-4-(pyrrolidin-1-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 71050438 |
| Molecular Formula | C22H28N2O2S |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | N-benzyl-N-(cyclopropylmethyl)-4-(pyrrolidin-1-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(c1ccc(CN2CCCC2)cc1)N(Cc1ccccc1)CC1CC1 |
| InChI | InChI=1S/C22H28N2O2S/c25-27(26,22-12-10-20(11-13-22)16-23-14-4-5-15-23)24(18-21-8-9-21)17-19-6-2-1-3-7-19/h1-3,6-7,10-13,21H,4-5,8-9,14-18H2 |
| InChIKey | CEZHOILMUBPZNG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |