C21H28N2O4S2 — CID 59826023
N-benzyl-N-methyl-4-[(4-methylsulfonylpiperidin-1-yl)methyl]benzenesulfonamide (PubChem CID 59826023) has the molecular formula C21H28N2O4S2 and a molecular weight of 436.60 g/mol. Its IUPAC name is N-benzyl-N-methyl-4-[(4-methylsulfonylpiperidin-1-yl)methyl]benzenesulfonamide.
| Compound Name | N-benzyl-N-methyl-4-[(4-methylsulfonylpiperidin-1-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 59826023 |
| Molecular Formula | C21H28N2O4S2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | N-benzyl-N-methyl-4-[(4-methylsulfonylpiperidin-1-yl)methyl]benzenesulfonamide |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)c1ccc(CN2CCC(S(C)(=O)=O)CC2)cc1 |
| InChI | InChI=1S/C21H28N2O4S2/c1-22(16-18-6-4-3-5-7-18)29(26,27)21-10-8-19(9-11-21)17-23-14-12-20(13-15-23)28(2,24)25/h3-11,20H,12-17H2,1-2H3 |
| InChIKey | MYLVYXUEWNDEFS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |