C20H27N3O2S — CID 59826329
N-benzyl-N-methyl-3-[(4-methylpiperazin-1-yl)methyl]benzenesulfonamide (PubChem CID 59826329) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is N-benzyl-N-methyl-3-[(4-methylpiperazin-1-yl)methyl]benzenesulfonamide.
| Compound Name | N-benzyl-N-methyl-3-[(4-methylpiperazin-1-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 59826329 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-benzyl-N-methyl-3-[(4-methylpiperazin-1-yl)methyl]benzenesulfonamide |
| SMILES | CN1CCN(Cc2cccc(S(=O)(=O)N(C)Cc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C20H27N3O2S/c1-21-11-13-23(14-12-21)17-19-9-6-10-20(15-19)26(24,25)22(2)16-18-7-4-3-5-8-18/h3-10,15H,11-14,16-17H2,1-2H3 |
| InChIKey | QTTVRZDIUXWGBB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |