C24H32N4O4S — CID 59826289
N-benzyl-N-methyl-3-[[4-(morpholine-4-carbonyl)piperazin-1-yl]methyl]benzenesulfonamide (PubChem CID 59826289) has the molecular formula C24H32N4O4S and a molecular weight of 472.61 g/mol. Its IUPAC name is N-benzyl-N-methyl-3-[[4-(morpholine-4-carbonyl)piperazin-1-yl]methyl]benzenesulfonamide.
| Compound Name | N-benzyl-N-methyl-3-[[4-(morpholine-4-carbonyl)piperazin-1-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 59826289 |
| Molecular Formula | C24H32N4O4S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | N-benzyl-N-methyl-3-[[4-(morpholine-4-carbonyl)piperazin-1-yl]methyl]benzenesulfonamide |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)c1cccc(CN2CCN(C(=O)N3CCOCC3)CC2)c1 |
| InChI | InChI=1S/C24H32N4O4S/c1-25(19-21-6-3-2-4-7-21)33(30,31)23-9-5-8-22(18-23)20-26-10-12-27(13-11-26)24(29)28-14-16-32-17-15-28/h2-9,18H,10-17,19-20H2,1H3 |
| InChIKey | JBLPNMPQIODCNF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |