C12H21NO3S — CID 113336435
2,2-dimethyl-5-(2-methyloxolan-3-yl)sulfonylpentanenitrile (PubChem CID 113336435) has the molecular formula C12H21NO3S and a molecular weight of 259.37 g/mol. Its IUPAC name is 2,2-dimethyl-5-(2-methyloxolan-3-yl)sulfonylpentanenitrile.
| Compound Name | 2,2-dimethyl-5-(2-methyloxolan-3-yl)sulfonylpentanenitrile |
|---|---|
| PubChem CID | 113336435 |
| Molecular Formula | C12H21NO3S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2,2-dimethyl-5-(2-methyloxolan-3-yl)sulfonylpentanenitrile |
| SMILES | CC1OCCC1S(=O)(=O)CCCC(C)(C)C#N |
| InChI | InChI=1S/C12H21NO3S/c1-10-11(5-7-16-10)17(14,15)8-4-6-12(2,3)9-13/h10-11H,4-8H2,1-3H3 |
| InChIKey | IAIKWCSJJQEZSN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |