C13H23NO3S — CID 106831667
2,2-dimethyl-6-(2-methyloxolan-3-yl)sulfonylhexanenitrile (PubChem CID 106831667) has the molecular formula C13H23NO3S and a molecular weight of 273.40 g/mol. Its IUPAC name is 2,2-dimethyl-6-(2-methyloxolan-3-yl)sulfonylhexanenitrile.
| Compound Name | 2,2-dimethyl-6-(2-methyloxolan-3-yl)sulfonylhexanenitrile |
|---|---|
| PubChem CID | 106831667 |
| Molecular Formula | C13H23NO3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 2,2-dimethyl-6-(2-methyloxolan-3-yl)sulfonylhexanenitrile |
| SMILES | CC1OCCC1S(=O)(=O)CCCCC(C)(C)C#N |
| InChI | InChI=1S/C13H23NO3S/c1-11-12(6-8-17-11)18(15,16)9-5-4-7-13(2,3)10-14/h11-12H,4-9H2,1-3H3 |
| InChIKey | ZZDBUJMEYAGLAQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|