C15H27NO2S — CID 106714667
2,2-dimethyl-6-(3-methylcyclohexyl)sulfonylhexanenitrile (PubChem CID 106714667) has the molecular formula C15H27NO2S and a molecular weight of 285.45 g/mol. Its IUPAC name is 2,2-dimethyl-6-(3-methylcyclohexyl)sulfonylhexanenitrile.
| Compound Name | 2,2-dimethyl-6-(3-methylcyclohexyl)sulfonylhexanenitrile |
|---|---|
| PubChem CID | 106714667 |
| Molecular Formula | C15H27NO2S |
| Molecular Weight | 285.45 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 2,2-dimethyl-6-(3-methylcyclohexyl)sulfonylhexanenitrile |
| SMILES | CC1CCCC(S(=O)(=O)CCCCC(C)(C)C#N)C1 |
| InChI | InChI=1S/C15H27NO2S/c1-13-7-6-8-14(11-13)19(17,18)10-5-4-9-15(2,3)12-16/h13-14H,4-11H2,1-3H3 |
| InChIKey | GNAUMEWKROXNQY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|